C20H30N2O5 — CID 135464263
3-[3,5-ditert-butyl-4-(2-methoxyethoxymethoxy)phenyl]-4H-1,2,4-oxadiazol-5-one (PubChem CID 135464263) has the molecular formula C20H30N2O5 and a molecular weight of 378.47 g/mol. Its IUPAC name is 3-[3,5-ditert-butyl-4-(2-methoxyethoxymethoxy)phenyl]-4H-1,2,4-oxadiazol-5-one.
| Compound Name | 3-[3,5-ditert-butyl-4-(2-methoxyethoxymethoxy)phenyl]-4H-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 135464263 |
| Molecular Formula | C20H30N2O5 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 3-[3,5-ditert-butyl-4-(2-methoxyethoxymethoxy)phenyl]-4H-1,2,4-oxadiazol-5-one |
| SMILES | COCCOCOc1c(C(C)(C)C)cc(-c2noc(=O)[nH]2)cc1C(C)(C)C |
| InChI | InChI=1S/C20H30N2O5/c1-19(2,3)14-10-13(17-21-18(23)27-22-17)11-15(20(4,5)6)16(14)26-12-25-9-8-24-7/h10-11H,8-9,12H2,1-7H3,(H,21,22,23) |
| InChIKey | RBBHDIZHMZTSPV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|