C26H28N2O7 — CID 135464648
6-hexyl-7-hydroxy-3-[5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]chromen-2-one (PubChem CID 135464648) has the molecular formula C26H28N2O7 and a molecular weight of 480.52 g/mol. Its IUPAC name is 6-hexyl-7-hydroxy-3-[5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]chromen-2-one.
| Compound Name | 6-hexyl-7-hydroxy-3-[5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]chromen-2-one |
|---|---|
| PubChem CID | 135464648 |
| Molecular Formula | C26H28N2O7 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | 6-hexyl-7-hydroxy-3-[5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]chromen-2-one |
| SMILES | CCCCCCc1cc2cc(-c3nnc(-c4cc(OC)c(OC)c(OC)c4)o3)c(=O)oc2cc1O |
| InChI | InChI=1S/C26H28N2O7/c1-5-6-7-8-9-15-10-16-11-18(26(30)34-20(16)14-19(15)29)25-28-27-24(35-25)17-12-21(31-2)23(33-4)22(13-17)32-3/h10-14,29H,5-9H2,1-4H3 |
| InChIKey | WCKFIDDCBFITOV-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 117.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|