About 4-[(E)-(3-methyl-1,4-diphenylpyrazol-5-yl)iminomethyl]phenol
4-[(E)-(3-methyl-1,4-diphenylpyrazol-5-yl)iminomethyl]phenol (PubChem CID 135464676) has the molecular formula C23H19N3O
and a molecular weight of 353.43 g/mol. Its IUPAC name is 4-[(E)-(3-methyl-1,4-diphenylpyrazol-5-yl)iminomethyl]phenol.
Molecular Properties
| Compound Name | 4-[(E)-(3-methyl-1,4-diphenylpyrazol-5-yl)iminomethyl]phenol |
| PubChem CID | 135464676 |
| Molecular Formula | C23H19N3O |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 4-[(E)-(3-methyl-1,4-diphenylpyrazol-5-yl)iminomethyl]phenol |
| SMILES | Cc1nn(-c2ccccc2)c(/N=C/c2ccc(O)cc2)c1-c1ccccc1 |
| InChI | InChI=1S/C23H19N3O/c1-17-22(19-8-4-2-5-9-19)23(24-16-18-12-14-21(27)15-13-18)26(25-17)20-10-6-3-7-11-20/h2-16,27H,1H3/b24-16+ |
| InChIKey | RXVFWGSBVGEYKM-LFVJCYFKSA-N |
| XLogP | 5.30 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-(3-methyl-1,4-diphenylpyrazol-5-yl)iminomethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-(3-methyl-1,4-diphenylpyrazol-5-yl)iminomethyl]phenol?
The IUPAC name of 4-[(E)-(3-methyl-1,4-diphenylpyrazol-5-yl)iminomethyl]phenol (CID 135464676) is 4-[(E)-(3-methyl-1,4-diphenylpyrazol-5-yl)iminomethyl]phenol.
What is the SMILES notation for 4-[(E)-(3-methyl-1,4-diphenylpyrazol-5-yl)iminomethyl]phenol?
The canonical SMILES for 4-[(E)-(3-methyl-1,4-diphenylpyrazol-5-yl)iminomethyl]phenol is Cc1nn(-c2ccccc2)c(/N=C/c2ccc(O)cc2)c1-c1ccccc1.
What is the InChIKey of 4-[(E)-(3-methyl-1,4-diphenylpyrazol-5-yl)iminomethyl]phenol?
The InChIKey is RXVFWGSBVGEYKM-LFVJCYFKSA-N. The full InChI is InChI=1S/C23H19N3O/c1-17-22(19-8-4-2-5-9-19)23(24-16-18-12-14-21(27)15-13-18)26(25-17)20-10-6-3-7-11-20/h2-16,27H,1H3/b24-16+.
What are the key properties of 4-[(E)-(3-methyl-1,4-diphenylpyrazol-5-yl)iminomethyl]phenol?
4-[(E)-(3-methyl-1,4-diphenylpyrazol-5-yl)iminomethyl]phenol has a molecular weight of 353.43 g/mol, XLogP of 5.30, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-(3-methyl-1,4-diphenylpyrazol-5-yl)iminomethyl]phenol is sourced from PubChem (CID 135464676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).