C17H17N3O4S3 — CID 135464881
ethyl 2-[[3-(4-ethoxyphenyl)-7-oxo-2-sulfanylidene-6H-[1,3]thiazolo[4,5-d]pyrimidin-5-yl]sulfanyl]acetate (PubChem CID 135464881) has the molecular formula C17H17N3O4S3 and a molecular weight of 423.54 g/mol. Its IUPAC name is ethyl 2-[[3-(4-ethoxyphenyl)-7-oxo-2-sulfanylidene-6H-[1,3]thiazolo[4,5-d]pyrimidin-5-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[3-(4-ethoxyphenyl)-7-oxo-2-sulfanylidene-6H-[1,3]thiazolo[4,5-d]pyrimidin-5-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 135464881 |
| Molecular Formula | C17H17N3O4S3 |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.04 |
| IUPAC Name | ethyl 2-[[3-(4-ethoxyphenyl)-7-oxo-2-sulfanylidene-6H-[1,3]thiazolo[4,5-d]pyrimidin-5-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nc2c(sc(=S)n2-c2ccc(OCC)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C17H17N3O4S3/c1-3-23-11-7-5-10(6-8-11)20-14-13(27-17(20)25)15(22)19-16(18-14)26-9-12(21)24-4-2/h5-8H,3-4,9H2,1-2H3,(H,18,19,22) |
| InChIKey | PUQTXJRFLBMLCT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|