About 2-amino-3,5-dihydropteridine-4,6-dione;hydrate
2-amino-3,5-dihydropteridine-4,6-dione;hydrate (PubChem CID 135465063) has the molecular formula C6H7N5O3
and a molecular weight of 197.15 g/mol. Its IUPAC name is 2-amino-3,5-dihydropteridine-4,6-dione;hydrate.
Molecular Properties
| Compound Name | 2-amino-3,5-dihydropteridine-4,6-dione;hydrate |
| PubChem CID | 135465063 |
| Molecular Formula | C6H7N5O3 |
| Molecular Weight | 197.15 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | 2-amino-3,5-dihydropteridine-4,6-dione;hydrate |
| SMILES | Nc1nc2ncc(=O)[nH]c2c(=O)[nH]1.O |
| InChI | InChI=1S/C6H5N5O2.H2O/c7-6-10-4-3(5(13)11-6)9-2(12)1-8-4;/h1H,(H,9,12)(H3,7,8,10,11,13);1H2 |
| InChIKey | GXYCFNCAIXIUMR-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 149.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.15 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-3,5-dihydropteridine-4,6-dione;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3,5-dihydropteridine-4,6-dione;hydrate?
The IUPAC name of 2-amino-3,5-dihydropteridine-4,6-dione;hydrate (CID 135465063) is 2-amino-3,5-dihydropteridine-4,6-dione;hydrate.
What is the SMILES notation for 2-amino-3,5-dihydropteridine-4,6-dione;hydrate?
The canonical SMILES for 2-amino-3,5-dihydropteridine-4,6-dione;hydrate is Nc1nc2ncc(=O)[nH]c2c(=O)[nH]1.O.
What is the InChIKey of 2-amino-3,5-dihydropteridine-4,6-dione;hydrate?
The InChIKey is GXYCFNCAIXIUMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N5O2.H2O/c7-6-10-4-3(5(13)11-6)9-2(12)1-8-4;/h1H,(H,9,12)(H3,7,8,10,11,13);1H2.
What are the key properties of 2-amino-3,5-dihydropteridine-4,6-dione;hydrate?
2-amino-3,5-dihydropteridine-4,6-dione;hydrate has a molecular weight of 197.15 g/mol, XLogP of -2.24, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3,5-dihydropteridine-4,6-dione;hydrate is sourced from PubChem (CID 135465063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).