C13H9Cl3N4O — CID 135465553
2-amino-7-[(2,3,5-trichlorophenyl)methyl]-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 135465553) has the molecular formula C13H9Cl3N4O and a molecular weight of 343.60 g/mol. Its IUPAC name is 2-amino-7-[(2,3,5-trichlorophenyl)methyl]-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one.
| Compound Name | 2-amino-7-[(2,3,5-trichlorophenyl)methyl]-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135465553 |
| Molecular Formula | C13H9Cl3N4O |
| Molecular Weight | 343.60 g/mol |
| Exact Mass | 341.98 |
| IUPAC Name | 2-amino-7-[(2,3,5-trichlorophenyl)methyl]-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | Nc1nc2c(Cc3cc(Cl)cc(Cl)c3Cl)c[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C13H9Cl3N4O/c14-7-2-5(9(16)8(15)3-7)1-6-4-18-11-10(6)19-13(17)20-12(11)21/h2-4,18H,1H2,(H3,17,19,20,21) |
| InChIKey | RZCKSKZVJBTDGA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.60 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|