C17H16N2O — CID 135465890
4,5-dimethyl-2-(3-phenyl-1H-pyrazol-5-yl)phenol (PubChem CID 135465890) has the molecular formula C17H16N2O and a molecular weight of 264.33 g/mol. Its IUPAC name is 4,5-dimethyl-2-(3-phenyl-1H-pyrazol-5-yl)phenol.
| Compound Name | 4,5-dimethyl-2-(3-phenyl-1H-pyrazol-5-yl)phenol |
|---|---|
| PubChem CID | 135465890 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 4,5-dimethyl-2-(3-phenyl-1H-pyrazol-5-yl)phenol |
| SMILES | Cc1cc(O)c(-c2cc(-c3ccccc3)n[nH]2)cc1C |
| InChI | InChI=1S/C17H16N2O/c1-11-8-14(17(20)9-12(11)2)16-10-15(18-19-16)13-6-4-3-5-7-13/h3-10,20H,1-2H3,(H,18,19) |
| InChIKey | WOENIPNSDYRCNF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |