About dimethyl (3E)-2-benzylimino-3-(2,2,2-trifluoro-1-hydroxyethylidene)butanedioate
dimethyl (3E)-2-benzylimino-3-(2,2,2-trifluoro-1-hydroxyethylidene)butanedioate (PubChem CID 135465956) has the molecular formula C15H14F3NO5
and a molecular weight of 345.27 g/mol. Its IUPAC name is dimethyl (3E)-2-benzylimino-3-(2,2,2-trifluoro-1-hydroxyethylidene)butanedioate.
Molecular Properties
| Compound Name | dimethyl (3E)-2-benzylimino-3-(2,2,2-trifluoro-1-hydroxyethylidene)butanedioate |
| PubChem CID | 135465956 |
| Molecular Formula | C15H14F3NO5 |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | dimethyl (3E)-2-benzylimino-3-(2,2,2-trifluoro-1-hydroxyethylidene)butanedioate |
| SMILES | COC(=O)C(=N\Cc1ccccc1)/C(C(=O)OC)=C(\O)C(F)(F)F |
| InChI | InChI=1S/C15H14F3NO5/c1-23-13(21)10(12(20)15(16,17)18)11(14(22)24-2)19-8-9-6-4-3-5-7-9/h3-7,20H,8H2,1-2H3/b12-10+,19-11- |
| InChIKey | CSLLVZRIKRFYEX-PSMKESGGSA-N |
| XLogP | 2.35 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (3E)-2-benzylimino-3-(2,2,2-trifluoro-1-hydroxyethylidene)butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (3E)-2-benzylimino-3-(2,2,2-trifluoro-1-hydroxyethylidene)butanedioate?
The IUPAC name of dimethyl (3E)-2-benzylimino-3-(2,2,2-trifluoro-1-hydroxyethylidene)butanedioate (CID 135465956) is dimethyl (3E)-2-benzylimino-3-(2,2,2-trifluoro-1-hydroxyethylidene)butanedioate.
What is the SMILES notation for dimethyl (3E)-2-benzylimino-3-(2,2,2-trifluoro-1-hydroxyethylidene)butanedioate?
The canonical SMILES for dimethyl (3E)-2-benzylimino-3-(2,2,2-trifluoro-1-hydroxyethylidene)butanedioate is COC(=O)C(=N\Cc1ccccc1)/C(C(=O)OC)=C(\O)C(F)(F)F.
What is the InChIKey of dimethyl (3E)-2-benzylimino-3-(2,2,2-trifluoro-1-hydroxyethylidene)butanedioate?
The InChIKey is CSLLVZRIKRFYEX-PSMKESGGSA-N. The full InChI is InChI=1S/C15H14F3NO5/c1-23-13(21)10(12(20)15(16,17)18)11(14(22)24-2)19-8-9-6-4-3-5-7-9/h3-7,20H,8H2,1-2H3/b12-10+,19-11-.
What are the key properties of dimethyl (3E)-2-benzylimino-3-(2,2,2-trifluoro-1-hydroxyethylidene)butanedioate?
dimethyl (3E)-2-benzylimino-3-(2,2,2-trifluoro-1-hydroxyethylidene)butanedioate has a molecular weight of 345.27 g/mol, XLogP of 2.35, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (3E)-2-benzylimino-3-(2,2,2-trifluoro-1-hydroxyethylidene)butanedioate is sourced from PubChem (CID 135465956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).