About cyclobuta[b]quinoxaline-1,2-diol
cyclobuta[b]quinoxaline-1,2-diol (PubChem CID 135465965) has the molecular formula C10H6N2O2
and a molecular weight of 186.17 g/mol. Its IUPAC name is cyclobuta[b]quinoxaline-1,2-diol.
Molecular Properties
| Compound Name | cyclobuta[b]quinoxaline-1,2-diol |
| PubChem CID | 135465965 |
| Molecular Formula | C10H6N2O2 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | cyclobuta[b]quinoxaline-1,2-diol |
| SMILES | OC1=C(O)c2nc3ccccc3nc21 |
| InChI | InChI=1S/C10H6N2O2/c13-9-7-8(10(9)14)12-6-4-2-1-3-5(6)11-7/h1-4,13-14H |
| InChIKey | KQYCKLYTVAUTRI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclobuta[b]quinoxaline-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobuta[b]quinoxaline-1,2-diol?
The IUPAC name of cyclobuta[b]quinoxaline-1,2-diol (CID 135465965) is cyclobuta[b]quinoxaline-1,2-diol.
What is the SMILES notation for cyclobuta[b]quinoxaline-1,2-diol?
The canonical SMILES for cyclobuta[b]quinoxaline-1,2-diol is OC1=C(O)c2nc3ccccc3nc21.
What is the InChIKey of cyclobuta[b]quinoxaline-1,2-diol?
The InChIKey is KQYCKLYTVAUTRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N2O2/c13-9-7-8(10(9)14)12-6-4-2-1-3-5(6)11-7/h1-4,13-14H.
What are the key properties of cyclobuta[b]quinoxaline-1,2-diol?
cyclobuta[b]quinoxaline-1,2-diol has a molecular weight of 186.17 g/mol, XLogP of 1.88, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobuta[b]quinoxaline-1,2-diol is sourced from PubChem (CID 135465965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).