About 3,5-diacetyl-4,6-dihydroxypyran-2-one
3,5-diacetyl-4,6-dihydroxypyran-2-one (PubChem CID 135465969) has the molecular formula C9H8O6
and a molecular weight of 212.16 g/mol. Its IUPAC name is 3,5-diacetyl-4,6-dihydroxypyran-2-one.
Molecular Properties
| Compound Name | 3,5-diacetyl-4,6-dihydroxypyran-2-one |
| PubChem CID | 135465969 |
| Molecular Formula | C9H8O6 |
| Molecular Weight | 212.16 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | 3,5-diacetyl-4,6-dihydroxypyran-2-one |
| SMILES | CC(=O)c1c(O)oc(=O)c(C(C)=O)c1O |
| InChI | InChI=1S/C9H8O6/c1-3(10)5-7(12)6(4(2)11)9(14)15-8(5)13/h12-13H,1-2H3 |
| InChIKey | ISDVKWGLGFGXJD-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.16 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3,5-diacetyl-4,6-dihydroxypyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diacetyl-4,6-dihydroxypyran-2-one?
The IUPAC name of 3,5-diacetyl-4,6-dihydroxypyran-2-one (CID 135465969) is 3,5-diacetyl-4,6-dihydroxypyran-2-one.
What is the SMILES notation for 3,5-diacetyl-4,6-dihydroxypyran-2-one?
The canonical SMILES for 3,5-diacetyl-4,6-dihydroxypyran-2-one is CC(=O)c1c(O)oc(=O)c(C(C)=O)c1O.
What is the InChIKey of 3,5-diacetyl-4,6-dihydroxypyran-2-one?
The InChIKey is ISDVKWGLGFGXJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O6/c1-3(10)5-7(12)6(4(2)11)9(14)15-8(5)13/h12-13H,1-2H3.
What are the key properties of 3,5-diacetyl-4,6-dihydroxypyran-2-one?
3,5-diacetyl-4,6-dihydroxypyran-2-one has a molecular weight of 212.16 g/mol, XLogP of 0.46, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diacetyl-4,6-dihydroxypyran-2-one is sourced from PubChem (CID 135465969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).