C17H15N3O5S2 — CID 135466197
ethyl 2-[(E)-(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)methylideneamino]-4-(5-methylfuran-2-yl)thiophene-3-carboxylate (PubChem CID 135466197) has the molecular formula C17H15N3O5S2 and a molecular weight of 405.46 g/mol. Its IUPAC name is ethyl 2-[(E)-(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)methylideneamino]-4-(5-methylfuran-2-yl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[(E)-(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)methylideneamino]-4-(5-methylfuran-2-yl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 135466197 |
| Molecular Formula | C17H15N3O5S2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | ethyl 2-[(E)-(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)methylideneamino]-4-(5-methylfuran-2-yl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)o2)csc1/N=C/c1c(O)[nH]c(=S)[nH]c1=O |
| InChI | InChI=1S/C17H15N3O5S2/c1-3-24-16(23)12-10(11-5-4-8(2)25-11)7-27-15(12)18-6-9-13(21)19-17(26)20-14(9)22/h4-7H,3H2,1-2H3,(H3,19,20,21,22,26)/b18-6+ |
| InChIKey | LDRDZSVHCPGWQT-NGYBGAFCSA-N |
| XLogP | 3.70 |
| TPSA | 120.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|