C26H22FN5O3S2 — CID 135466287
(Z)-4-[[4-cyclopropyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-hydroxybut-2-enenitrile (PubChem CID 135466287) has the molecular formula C26H22FN5O3S2 and a molecular weight of 535.63 g/mol. Its IUPAC name is (Z)-4-[[4-cyclopropyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-hydroxybut-2-enenitrile.
| Compound Name | (Z)-4-[[4-cyclopropyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-hydroxybut-2-enenitrile |
|---|---|
| PubChem CID | 135466287 |
| Molecular Formula | C26H22FN5O3S2 |
| Molecular Weight | 535.63 g/mol |
| Exact Mass | 535.11 |
| IUPAC Name | (Z)-4-[[4-cyclopropyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-hydroxybut-2-enenitrile |
| SMILES | COc1ccc(-c2csc(/C(C#N)=C(\O)CSc3nnc(-c4ccccc4F)n3C3CC3)n2)cc1OC |
| InChI | InChI=1S/C26H22FN5O3S2/c1-34-22-10-7-15(11-23(22)35-2)20-13-36-25(29-20)18(12-28)21(33)14-37-26-31-30-24(32(26)16-8-9-16)17-5-3-4-6-19(17)27/h3-7,10-11,13,16,33H,8-9,14H2,1-2H3/b21-18- |
| InChIKey | UBRQGIJTFDXSSK-UZYVYHOESA-N |
| XLogP | 6.14 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.63 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|