About (Z)-N'-(2,6-dimethoxy-3-pyridinyl)-3-hydroxy-3-phenylprop-2-enimidamide
(Z)-N'-(2,6-dimethoxy-3-pyridinyl)-3-hydroxy-3-phenylprop-2-enimidamide (PubChem CID 135466466) has the molecular formula C16H17N3O3
and a molecular weight of 299.33 g/mol. Its IUPAC name is (Z)-N'-(2,6-dimethoxy-3-pyridinyl)-3-hydroxy-3-phenylprop-2-enimidamide.
Molecular Properties
| Compound Name | (Z)-N'-(2,6-dimethoxy-3-pyridinyl)-3-hydroxy-3-phenylprop-2-enimidamide |
| PubChem CID | 135466466 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (Z)-N'-(2,6-dimethoxy-3-pyridinyl)-3-hydroxy-3-phenylprop-2-enimidamide |
| SMILES | COc1ccc(/N=C(N)/C=C(\O)c2ccccc2)c(OC)n1 |
| InChI | InChI=1S/C16H17N3O3/c1-21-15-9-8-12(16(19-15)22-2)18-14(17)10-13(20)11-6-4-3-5-7-11/h3-10,20H,1-2H3,(H2,17,18)/b13-10- |
| InChIKey | JBWZEBYBIHUIIZ-RAXLEYEMSA-N |
| XLogP | 2.69 |
| TPSA | 89.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N'-(2,6-dimethoxy-3-pyridinyl)-3-hydroxy-3-phenylprop-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N'-(2,6-dimethoxy-3-pyridinyl)-3-hydroxy-3-phenylprop-2-enimidamide?
The IUPAC name of (Z)-N'-(2,6-dimethoxy-3-pyridinyl)-3-hydroxy-3-phenylprop-2-enimidamide (CID 135466466) is (Z)-N'-(2,6-dimethoxy-3-pyridinyl)-3-hydroxy-3-phenylprop-2-enimidamide.
What is the SMILES notation for (Z)-N'-(2,6-dimethoxy-3-pyridinyl)-3-hydroxy-3-phenylprop-2-enimidamide?
The canonical SMILES for (Z)-N'-(2,6-dimethoxy-3-pyridinyl)-3-hydroxy-3-phenylprop-2-enimidamide is COc1ccc(/N=C(N)/C=C(\O)c2ccccc2)c(OC)n1.
What is the InChIKey of (Z)-N'-(2,6-dimethoxy-3-pyridinyl)-3-hydroxy-3-phenylprop-2-enimidamide?
The InChIKey is JBWZEBYBIHUIIZ-RAXLEYEMSA-N. The full InChI is InChI=1S/C16H17N3O3/c1-21-15-9-8-12(16(19-15)22-2)18-14(17)10-13(20)11-6-4-3-5-7-11/h3-10,20H,1-2H3,(H2,17,18)/b13-10-.
What are the key properties of (Z)-N'-(2,6-dimethoxy-3-pyridinyl)-3-hydroxy-3-phenylprop-2-enimidamide?
(Z)-N'-(2,6-dimethoxy-3-pyridinyl)-3-hydroxy-3-phenylprop-2-enimidamide has a molecular weight of 299.33 g/mol, XLogP of 2.69, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N'-(2,6-dimethoxy-3-pyridinyl)-3-hydroxy-3-phenylprop-2-enimidamide is sourced from PubChem (CID 135466466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).