C25H29N5O4 — CID 135466566
methyl 3-[5-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]methyl]-1H-indol-2-yl]-1H-indazole-6-carboxylate (PubChem CID 135466566) has the molecular formula C25H29N5O4 and a molecular weight of 463.54 g/mol. Its IUPAC name is methyl 3-[5-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]methyl]-1H-indol-2-yl]-1H-indazole-6-carboxylate.
| Compound Name | methyl 3-[5-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]methyl]-1H-indol-2-yl]-1H-indazole-6-carboxylate |
|---|---|
| PubChem CID | 135466566 |
| Molecular Formula | C25H29N5O4 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | methyl 3-[5-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]methyl]-1H-indol-2-yl]-1H-indazole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(-c3cc4cc(CNCCNC(=O)OC(C)(C)C)ccc4[nH]3)n[nH]c2c1 |
| InChI | InChI=1S/C25H29N5O4/c1-25(2,3)34-24(32)27-10-9-26-14-15-5-8-19-17(11-15)13-21(28-19)22-18-7-6-16(23(31)33-4)12-20(18)29-30-22/h5-8,11-13,26,28H,9-10,14H2,1-4H3,(H,27,32)(H,29,30) |
| InChIKey | XSZAVQBXKGQTPR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|