About 2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl 4-fluorobenzoate
2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl 4-fluorobenzoate (PubChem CID 135466635) has the molecular formula C18H17FN2O5S
and a molecular weight of 392.41 g/mol. Its IUPAC name is 2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl 4-fluorobenzoate.
Molecular Properties
| Compound Name | 2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl 4-fluorobenzoate |
| PubChem CID | 135466635 |
| Molecular Formula | C18H17FN2O5S |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl 4-fluorobenzoate |
| SMILES | O=C(OCCOCC/N=C1\NS(=O)(=O)c2ccccc21)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H17FN2O5S/c19-14-7-5-13(6-8-14)18(22)26-12-11-25-10-9-20-17-15-3-1-2-4-16(15)27(23,24)21-17/h1-8H,9-12H2,(H,20,21) |
| InChIKey | HLDWJMHDDFNCNH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl 4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl 4-fluorobenzoate?
The IUPAC name of 2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl 4-fluorobenzoate (CID 135466635) is 2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl 4-fluorobenzoate.
What is the SMILES notation for 2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl 4-fluorobenzoate?
The canonical SMILES for 2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl 4-fluorobenzoate is O=C(OCCOCC/N=C1\NS(=O)(=O)c2ccccc21)c1ccc(F)cc1.
What is the InChIKey of 2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl 4-fluorobenzoate?
The InChIKey is HLDWJMHDDFNCNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17FN2O5S/c19-14-7-5-13(6-8-14)18(22)26-12-11-25-10-9-20-17-15-3-1-2-4-16(15)27(23,24)21-17/h1-8H,9-12H2,(H,20,21).
What are the key properties of 2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl 4-fluorobenzoate?
2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl 4-fluorobenzoate has a molecular weight of 392.41 g/mol, XLogP of 1.74, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl 4-fluorobenzoate is sourced from PubChem (CID 135466635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).