About ethyl 2-[(3,4-dichlorophenyl)diazenyl]-3-hydroxybut-2-enoate
ethyl 2-[(3,4-dichlorophenyl)diazenyl]-3-hydroxybut-2-enoate (PubChem CID 135466685) has the molecular formula C12H12Cl2N2O3
and a molecular weight of 303.15 g/mol. Its IUPAC name is ethyl 2-[(3,4-dichlorophenyl)diazenyl]-3-hydroxybut-2-enoate.
Molecular Properties
| Compound Name | ethyl 2-[(3,4-dichlorophenyl)diazenyl]-3-hydroxybut-2-enoate |
| PubChem CID | 135466685 |
| Molecular Formula | C12H12Cl2N2O3 |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | ethyl 2-[(3,4-dichlorophenyl)diazenyl]-3-hydroxybut-2-enoate |
| SMILES | CCOC(=O)C(/N=N/c1ccc(Cl)c(Cl)c1)=C(C)O |
| InChI | InChI=1S/C12H12Cl2N2O3/c1-3-19-12(18)11(7(2)17)16-15-8-4-5-9(13)10(14)6-8/h4-6,17H,3H2,1-2H3/b11-7?,16-15+ |
| InChIKey | YLRHPYCQDCLKQA-ONJAMPQUSA-N |
| XLogP | 4.43 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[(3,4-dichlorophenyl)diazenyl]-3-hydroxybut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(3,4-dichlorophenyl)diazenyl]-3-hydroxybut-2-enoate?
The IUPAC name of ethyl 2-[(3,4-dichlorophenyl)diazenyl]-3-hydroxybut-2-enoate (CID 135466685) is ethyl 2-[(3,4-dichlorophenyl)diazenyl]-3-hydroxybut-2-enoate.
What is the SMILES notation for ethyl 2-[(3,4-dichlorophenyl)diazenyl]-3-hydroxybut-2-enoate?
The canonical SMILES for ethyl 2-[(3,4-dichlorophenyl)diazenyl]-3-hydroxybut-2-enoate is CCOC(=O)C(/N=N/c1ccc(Cl)c(Cl)c1)=C(C)O.
What is the InChIKey of ethyl 2-[(3,4-dichlorophenyl)diazenyl]-3-hydroxybut-2-enoate?
The InChIKey is YLRHPYCQDCLKQA-ONJAMPQUSA-N. The full InChI is InChI=1S/C12H12Cl2N2O3/c1-3-19-12(18)11(7(2)17)16-15-8-4-5-9(13)10(14)6-8/h4-6,17H,3H2,1-2H3/b11-7?,16-15+.
What are the key properties of ethyl 2-[(3,4-dichlorophenyl)diazenyl]-3-hydroxybut-2-enoate?
ethyl 2-[(3,4-dichlorophenyl)diazenyl]-3-hydroxybut-2-enoate has a molecular weight of 303.15 g/mol, XLogP of 4.43, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(3,4-dichlorophenyl)diazenyl]-3-hydroxybut-2-enoate is sourced from PubChem (CID 135466685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).