About 3-(5,7-ditert-butyl-2-hydroxy-1-benzofuran-3-yl)indol-2-one
3-(5,7-ditert-butyl-2-hydroxy-1-benzofuran-3-yl)indol-2-one (PubChem CID 135467138) has the molecular formula C24H25NO3
and a molecular weight of 375.47 g/mol. Its IUPAC name is 3-(5,7-ditert-butyl-2-hydroxy-1-benzofuran-3-yl)indol-2-one.
Molecular Properties
| Compound Name | 3-(5,7-ditert-butyl-2-hydroxy-1-benzofuran-3-yl)indol-2-one |
| PubChem CID | 135467138 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 3-(5,7-ditert-butyl-2-hydroxy-1-benzofuran-3-yl)indol-2-one |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2oc(O)c(C3=c4ccccc4=NC3=O)c2c1 |
| InChI | InChI=1S/C24H25NO3/c1-23(2,3)13-11-15-19(18-14-9-7-8-10-17(14)25-21(18)26)22(27)28-20(15)16(12-13)24(4,5)6/h7-12,27H,1-6H3 |
| InChIKey | GFXUHCYVTAMWAP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 62.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(5,7-ditert-butyl-2-hydroxy-1-benzofuran-3-yl)indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5,7-ditert-butyl-2-hydroxy-1-benzofuran-3-yl)indol-2-one?
The IUPAC name of 3-(5,7-ditert-butyl-2-hydroxy-1-benzofuran-3-yl)indol-2-one (CID 135467138) is 3-(5,7-ditert-butyl-2-hydroxy-1-benzofuran-3-yl)indol-2-one.
What is the SMILES notation for 3-(5,7-ditert-butyl-2-hydroxy-1-benzofuran-3-yl)indol-2-one?
The canonical SMILES for 3-(5,7-ditert-butyl-2-hydroxy-1-benzofuran-3-yl)indol-2-one is CC(C)(C)c1cc(C(C)(C)C)c2oc(O)c(C3=c4ccccc4=NC3=O)c2c1.
What is the InChIKey of 3-(5,7-ditert-butyl-2-hydroxy-1-benzofuran-3-yl)indol-2-one?
The InChIKey is GFXUHCYVTAMWAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25NO3/c1-23(2,3)13-11-15-19(18-14-9-7-8-10-17(14)25-21(18)26)22(27)28-20(15)16(12-13)24(4,5)6/h7-12,27H,1-6H3.
What are the key properties of 3-(5,7-ditert-butyl-2-hydroxy-1-benzofuran-3-yl)indol-2-one?
3-(5,7-ditert-butyl-2-hydroxy-1-benzofuran-3-yl)indol-2-one has a molecular weight of 375.47 g/mol, XLogP of 4.09, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5,7-ditert-butyl-2-hydroxy-1-benzofuran-3-yl)indol-2-one is sourced from PubChem (CID 135467138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).