C18H12F3N3OS — CID 135467326
4-(1,3-benzothiazol-2-yl)-5-imino-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-3-ol (PubChem CID 135467326) has the molecular formula C18H12F3N3OS and a molecular weight of 375.38 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-5-imino-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-3-ol.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-5-imino-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 135467326 |
| Molecular Formula | C18H12F3N3OS |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-5-imino-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc3ccccc3s2)=C(O)CN1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H12F3N3OS/c19-18(20,21)10-4-3-5-11(8-10)24-9-13(25)15(16(24)22)17-23-12-6-1-2-7-14(12)26-17/h1-8,22,25H,9H2/b22-16- |
| InChIKey | DWMAKBYHYUUYBO-JWGURIENSA-N |
| XLogP | 5.08 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|