C13H14N4O2S — CID 135467358
N-[2-(3-ethylsulfanyl-5-oxo-4H-1,2,4-triazin-6-yl)phenyl]acetamide (PubChem CID 135467358) has the molecular formula C13H14N4O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is N-[2-(3-ethylsulfanyl-5-oxo-4H-1,2,4-triazin-6-yl)phenyl]acetamide.
| Compound Name | N-[2-(3-ethylsulfanyl-5-oxo-4H-1,2,4-triazin-6-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 135467358 |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | N-[2-(3-ethylsulfanyl-5-oxo-4H-1,2,4-triazin-6-yl)phenyl]acetamide |
| SMILES | CCSc1nnc(-c2ccccc2NC(C)=O)c(=O)[nH]1 |
| InChI | InChI=1S/C13H14N4O2S/c1-3-20-13-15-12(19)11(16-17-13)9-6-4-5-7-10(9)14-8(2)18/h4-7H,3H2,1-2H3,(H,14,18)(H,15,17,19) |
| InChIKey | FKEKOBSQBLJZHD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |