About 4-amino-2-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)-1H-pyrimidin-6-one
4-amino-2-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)-1H-pyrimidin-6-one (PubChem CID 135467483) has the molecular formula C11H10N6OS
and a molecular weight of 274.31 g/mol. Its IUPAC name is 4-amino-2-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 4-amino-2-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)-1H-pyrimidin-6-one |
| PubChem CID | 135467483 |
| Molecular Formula | C11H10N6OS |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 4-amino-2-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)-1H-pyrimidin-6-one |
| SMILES | Nc1cc(=O)[nH]c(SCc2cn3cccnc3n2)n1 |
| InChI | InChI=1S/C11H10N6OS/c12-8-4-9(18)16-11(15-8)19-6-7-5-17-3-1-2-13-10(17)14-7/h1-5H,6H2,(H3,12,15,16,18) |
| InChIKey | IWTAEXJMYXCJMD-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-amino-2-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)-1H-pyrimidin-6-one?
The IUPAC name of 4-amino-2-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)-1H-pyrimidin-6-one (CID 135467483) is 4-amino-2-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)-1H-pyrimidin-6-one.
What is the SMILES notation for 4-amino-2-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)-1H-pyrimidin-6-one?
The canonical SMILES for 4-amino-2-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)-1H-pyrimidin-6-one is Nc1cc(=O)[nH]c(SCc2cn3cccnc3n2)n1.
What is the InChIKey of 4-amino-2-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)-1H-pyrimidin-6-one?
The InChIKey is IWTAEXJMYXCJMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N6OS/c12-8-4-9(18)16-11(15-8)19-6-7-5-17-3-1-2-13-10(17)14-7/h1-5H,6H2,(H3,12,15,16,18).
What are the key properties of 4-amino-2-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)-1H-pyrimidin-6-one?
4-amino-2-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)-1H-pyrimidin-6-one has a molecular weight of 274.31 g/mol, XLogP of 0.69, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)-1H-pyrimidin-6-one is sourced from PubChem (CID 135467483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).