C22H27CoN2O4- — CID 135467854
cobalt;2-[[6-(2-hydroxyethoxy)-2-[(2-hydroxyphenyl)methylideneamino]hexyl]iminomethyl]phenol (PubChem CID 135467854) has the molecular formula C22H27CoN2O4- and a molecular weight of 442.40 g/mol. Its IUPAC name is cobalt;2-[[6-(2-hydroxyethoxy)-2-[(2-hydroxyphenyl)methylideneamino]hexyl]iminomethyl]phenol.
| Compound Name | cobalt;2-[[6-(2-hydroxyethoxy)-2-[(2-hydroxyphenyl)methylideneamino]hexyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135467854 |
| Molecular Formula | C22H27CoN2O4- |
| Molecular Weight | 442.40 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | cobalt;2-[[6-(2-hydroxyethoxy)-2-[(2-hydroxyphenyl)methylideneamino]hexyl]iminomethyl]phenol |
| SMILES | OCCOC[CH-]CCC(C/N=C/c1ccccc1O)/N=C/c1ccccc1O.[Co] |
| InChI | InChI=1S/C22H27N2O4.Co/c25-12-14-28-13-6-5-9-20(24-16-19-8-2-4-11-22(19)27)17-23-15-18-7-1-3-10-21(18)26;/h1-4,6-8,10-11,15-16,20,25-27H,5,9,12-14,17H2;/q-1;/b23-15+,24-16+; |
| InChIKey | WYBSFFKXPASNLX-XGPVMEEKSA-N |
| XLogP | 3.00 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|