About 2-chloro-1H-[1,2,4]triazolo[5,1-f]purine
2-chloro-1H-[1,2,4]triazolo[5,1-f]purine (PubChem CID 135468174) has the molecular formula C6H3ClN6
and a molecular weight of 194.59 g/mol. Its IUPAC name is 2-chloro-1H-[1,2,4]triazolo[5,1-f]purine.
Molecular Properties
| Compound Name | 2-chloro-1H-[1,2,4]triazolo[5,1-f]purine |
| PubChem CID | 135468174 |
| Molecular Formula | C6H3ClN6 |
| Molecular Weight | 194.59 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | 2-chloro-1H-[1,2,4]triazolo[5,1-f]purine |
| SMILES | Clc1nc2ncn3ncnc3c2[nH]1 |
| InChI | InChI=1S/C6H3ClN6/c7-6-11-3-4(12-6)9-2-13-5(3)8-1-10-13/h1-2H,(H,11,12) |
| InChIKey | USXALPFVQROSIO-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.59 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-chloro-1H-[1,2,4]triazolo[5,1-f]purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1H-[1,2,4]triazolo[5,1-f]purine?
The IUPAC name of 2-chloro-1H-[1,2,4]triazolo[5,1-f]purine (CID 135468174) is 2-chloro-1H-[1,2,4]triazolo[5,1-f]purine.
What is the SMILES notation for 2-chloro-1H-[1,2,4]triazolo[5,1-f]purine?
The canonical SMILES for 2-chloro-1H-[1,2,4]triazolo[5,1-f]purine is Clc1nc2ncn3ncnc3c2[nH]1.
What is the InChIKey of 2-chloro-1H-[1,2,4]triazolo[5,1-f]purine?
The InChIKey is USXALPFVQROSIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3ClN6/c7-6-11-3-4(12-6)9-2-13-5(3)8-1-10-13/h1-2H,(H,11,12).
What are the key properties of 2-chloro-1H-[1,2,4]triazolo[5,1-f]purine?
2-chloro-1H-[1,2,4]triazolo[5,1-f]purine has a molecular weight of 194.59 g/mol, XLogP of 0.65, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1H-[1,2,4]triazolo[5,1-f]purine is sourced from PubChem (CID 135468174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).