About 5,10-dioxido-2-phenylbenzo[g]pteridine-5,10-diium-4-amine
5,10-dioxido-2-phenylbenzo[g]pteridine-5,10-diium-4-amine (PubChem CID 135468219) has the molecular formula C16H11N5O2
and a molecular weight of 305.30 g/mol. Its IUPAC name is 5,10-dioxido-2-phenylbenzo[g]pteridine-5,10-diium-4-amine.
Molecular Properties
| Compound Name | 5,10-dioxido-2-phenylbenzo[g]pteridine-5,10-diium-4-amine |
| PubChem CID | 135468219 |
| Molecular Formula | C16H11N5O2 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 5,10-dioxido-2-phenylbenzo[g]pteridine-5,10-diium-4-amine |
| SMILES | Nc1nc(-c2ccccc2)nc2c1[n+]([O-])c1ccccc1[n+]2[O-] |
| InChI | InChI=1S/C16H11N5O2/c17-14-13-16(19-15(18-14)10-6-2-1-3-7-10)21(23)12-9-5-4-8-11(12)20(13)22/h1-9H,(H2,17,18,19) |
| InChIKey | YWSUTRFYAQHJFZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5,10-dioxido-2-phenylbenzo[g]pteridine-5,10-diium-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,10-dioxido-2-phenylbenzo[g]pteridine-5,10-diium-4-amine?
The IUPAC name of 5,10-dioxido-2-phenylbenzo[g]pteridine-5,10-diium-4-amine (CID 135468219) is 5,10-dioxido-2-phenylbenzo[g]pteridine-5,10-diium-4-amine.
What is the SMILES notation for 5,10-dioxido-2-phenylbenzo[g]pteridine-5,10-diium-4-amine?
The canonical SMILES for 5,10-dioxido-2-phenylbenzo[g]pteridine-5,10-diium-4-amine is Nc1nc(-c2ccccc2)nc2c1[n+]([O-])c1ccccc1[n+]2[O-].
What is the InChIKey of 5,10-dioxido-2-phenylbenzo[g]pteridine-5,10-diium-4-amine?
The InChIKey is YWSUTRFYAQHJFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N5O2/c17-14-13-16(19-15(18-14)10-6-2-1-3-7-10)21(23)12-9-5-4-8-11(12)20(13)22/h1-9H,(H2,17,18,19).
What are the key properties of 5,10-dioxido-2-phenylbenzo[g]pteridine-5,10-diium-4-amine?
5,10-dioxido-2-phenylbenzo[g]pteridine-5,10-diium-4-amine has a molecular weight of 305.30 g/mol, XLogP of 1.30, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,10-dioxido-2-phenylbenzo[g]pteridine-5,10-diium-4-amine is sourced from PubChem (CID 135468219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).