About 4-(1,3-benzodioxol-5-yl)-6-oxo-2-piperidin-1-yl-1H-pyrimidine-5-carbonitrile
4-(1,3-benzodioxol-5-yl)-6-oxo-2-piperidin-1-yl-1H-pyrimidine-5-carbonitrile (PubChem CID 135468324) has the molecular formula C17H16N4O3
and a molecular weight of 324.34 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-6-oxo-2-piperidin-1-yl-1H-pyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 4-(1,3-benzodioxol-5-yl)-6-oxo-2-piperidin-1-yl-1H-pyrimidine-5-carbonitrile |
| PubChem CID | 135468324 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-6-oxo-2-piperidin-1-yl-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccc3c(c2)OCO3)nc(N2CCCCC2)[nH]c1=O |
| InChI | InChI=1S/C17H16N4O3/c18-9-12-15(11-4-5-13-14(8-11)24-10-23-13)19-17(20-16(12)22)21-6-2-1-3-7-21/h4-5,8H,1-3,6-7,10H2,(H,19,20,22) |
| InChIKey | JDFFLUSGYBZEGW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,3-benzodioxol-5-yl)-6-oxo-2-piperidin-1-yl-1H-pyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-benzodioxol-5-yl)-6-oxo-2-piperidin-1-yl-1H-pyrimidine-5-carbonitrile?
The IUPAC name of 4-(1,3-benzodioxol-5-yl)-6-oxo-2-piperidin-1-yl-1H-pyrimidine-5-carbonitrile (CID 135468324) is 4-(1,3-benzodioxol-5-yl)-6-oxo-2-piperidin-1-yl-1H-pyrimidine-5-carbonitrile.
What is the SMILES notation for 4-(1,3-benzodioxol-5-yl)-6-oxo-2-piperidin-1-yl-1H-pyrimidine-5-carbonitrile?
The canonical SMILES for 4-(1,3-benzodioxol-5-yl)-6-oxo-2-piperidin-1-yl-1H-pyrimidine-5-carbonitrile is N#Cc1c(-c2ccc3c(c2)OCO3)nc(N2CCCCC2)[nH]c1=O.
What is the InChIKey of 4-(1,3-benzodioxol-5-yl)-6-oxo-2-piperidin-1-yl-1H-pyrimidine-5-carbonitrile?
The InChIKey is JDFFLUSGYBZEGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4O3/c18-9-12-15(11-4-5-13-14(8-11)24-10-23-13)19-17(20-16(12)22)21-6-2-1-3-7-21/h4-5,8H,1-3,6-7,10H2,(H,19,20,22).
What are the key properties of 4-(1,3-benzodioxol-5-yl)-6-oxo-2-piperidin-1-yl-1H-pyrimidine-5-carbonitrile?
4-(1,3-benzodioxol-5-yl)-6-oxo-2-piperidin-1-yl-1H-pyrimidine-5-carbonitrile has a molecular weight of 324.34 g/mol, XLogP of 2.03, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzodioxol-5-yl)-6-oxo-2-piperidin-1-yl-1H-pyrimidine-5-carbonitrile is sourced from PubChem (CID 135468324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).