C19H23BrN6O2S — CID 135468464
2-[[5-(4-bromophenyl)-4-imino-3-methyl-2H-pyrazolo[3,4-d]pyrimidin-6-yl]sulfanyl]-N-(2-methoxyethyl)butanamide (PubChem CID 135468464) has the molecular formula C19H23BrN6O2S and a molecular weight of 479.40 g/mol. Its IUPAC name is 2-[[5-(4-bromophenyl)-4-imino-3-methyl-2H-pyrazolo[3,4-d]pyrimidin-6-yl]sulfanyl]-N-(2-methoxyethyl)butanamide.
| Compound Name | 2-[[5-(4-bromophenyl)-4-imino-3-methyl-2H-pyrazolo[3,4-d]pyrimidin-6-yl]sulfanyl]-N-(2-methoxyethyl)butanamide |
|---|---|
| PubChem CID | 135468464 |
| Molecular Formula | C19H23BrN6O2S |
| Molecular Weight | 479.40 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | 2-[[5-(4-bromophenyl)-4-imino-3-methyl-2H-pyrazolo[3,4-d]pyrimidin-6-yl]sulfanyl]-N-(2-methoxyethyl)butanamide |
| SMILES | [H]/N=c1\c2c(C)[nH]nc2nc(SC(CC)C(=O)NCCOC)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H23BrN6O2S/c1-4-14(18(27)22-9-10-28-3)29-19-23-17-15(11(2)24-25-17)16(21)26(19)13-7-5-12(20)6-8-13/h5-8,14,21H,4,9-10H2,1-3H3,(H,22,27)(H,24,25)/b21-16+ |
| InChIKey | BFQZYUVHZHACIO-LTGZKZEYSA-N |
| XLogP | 2.93 |
| TPSA | 108.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|