C15H16N4OS — CID 135468804
6-butan-2-ylsulfanyl-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 135468804) has the molecular formula C15H16N4OS and a molecular weight of 300.39 g/mol. Its IUPAC name is 6-butan-2-ylsulfanyl-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 6-butan-2-ylsulfanyl-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135468804 |
| Molecular Formula | C15H16N4OS |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 6-butan-2-ylsulfanyl-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CCC(C)Sc1nc2c(cnn2-c2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C15H16N4OS/c1-3-10(2)21-15-17-13-12(14(20)18-15)9-16-19(13)11-7-5-4-6-8-11/h4-10H,3H2,1-2H3,(H,17,18,20) |
| InChIKey | ZFZMXVYKZBAKJX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |