C16H19Cl2N3O — CID 135469041
2-(2,4-dichloroanilino)-4-methyl-5-(3-methylbutyl)-1H-pyrimidin-6-one (PubChem CID 135469041) has the molecular formula C16H19Cl2N3O and a molecular weight of 340.25 g/mol. Its IUPAC name is 2-(2,4-dichloroanilino)-4-methyl-5-(3-methylbutyl)-1H-pyrimidin-6-one.
| Compound Name | 2-(2,4-dichloroanilino)-4-methyl-5-(3-methylbutyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135469041 |
| Molecular Formula | C16H19Cl2N3O |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 2-(2,4-dichloroanilino)-4-methyl-5-(3-methylbutyl)-1H-pyrimidin-6-one |
| SMILES | Cc1nc(Nc2ccc(Cl)cc2Cl)[nH]c(=O)c1CCC(C)C |
| InChI | InChI=1S/C16H19Cl2N3O/c1-9(2)4-6-12-10(3)19-16(21-15(12)22)20-14-7-5-11(17)8-13(14)18/h5,7-9H,4,6H2,1-3H3,(H2,19,20,21,22) |
| InChIKey | YJZJCZOJUIQWLR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |