About 3-[(Z)-2-hydroxy-3,3-dimethylbut-1-enyl]-6-methyl-1,4-benzoxazin-2-one
3-[(Z)-2-hydroxy-3,3-dimethylbut-1-enyl]-6-methyl-1,4-benzoxazin-2-one (PubChem CID 135469893) has the molecular formula C15H17NO3
and a molecular weight of 259.31 g/mol. Its IUPAC name is 3-[(Z)-2-hydroxy-3,3-dimethylbut-1-enyl]-6-methyl-1,4-benzoxazin-2-one.
Molecular Properties
| Compound Name | 3-[(Z)-2-hydroxy-3,3-dimethylbut-1-enyl]-6-methyl-1,4-benzoxazin-2-one |
| PubChem CID | 135469893 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 3-[(Z)-2-hydroxy-3,3-dimethylbut-1-enyl]-6-methyl-1,4-benzoxazin-2-one |
| SMILES | Cc1ccc2oc(=O)c(/C=C(\O)C(C)(C)C)nc2c1 |
| InChI | InChI=1S/C15H17NO3/c1-9-5-6-12-10(7-9)16-11(14(18)19-12)8-13(17)15(2,3)4/h5-8,17H,1-4H3/b13-8- |
| InChIKey | YXLYRMLCEAYECT-JYRVWZFOSA-N |
| XLogP | 3.44 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 3-[(Z)-2-hydroxy-3,3-dimethylbut-1-enyl]-6-methyl-1,4-benzoxazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(Z)-2-hydroxy-3,3-dimethylbut-1-enyl]-6-methyl-1,4-benzoxazin-2-one?
The IUPAC name of 3-[(Z)-2-hydroxy-3,3-dimethylbut-1-enyl]-6-methyl-1,4-benzoxazin-2-one (CID 135469893) is 3-[(Z)-2-hydroxy-3,3-dimethylbut-1-enyl]-6-methyl-1,4-benzoxazin-2-one.
What is the SMILES notation for 3-[(Z)-2-hydroxy-3,3-dimethylbut-1-enyl]-6-methyl-1,4-benzoxazin-2-one?
The canonical SMILES for 3-[(Z)-2-hydroxy-3,3-dimethylbut-1-enyl]-6-methyl-1,4-benzoxazin-2-one is Cc1ccc2oc(=O)c(/C=C(\O)C(C)(C)C)nc2c1.
What is the InChIKey of 3-[(Z)-2-hydroxy-3,3-dimethylbut-1-enyl]-6-methyl-1,4-benzoxazin-2-one?
The InChIKey is YXLYRMLCEAYECT-JYRVWZFOSA-N. The full InChI is InChI=1S/C15H17NO3/c1-9-5-6-12-10(7-9)16-11(14(18)19-12)8-13(17)15(2,3)4/h5-8,17H,1-4H3/b13-8-.
What are the key properties of 3-[(Z)-2-hydroxy-3,3-dimethylbut-1-enyl]-6-methyl-1,4-benzoxazin-2-one?
3-[(Z)-2-hydroxy-3,3-dimethylbut-1-enyl]-6-methyl-1,4-benzoxazin-2-one has a molecular weight of 259.31 g/mol, XLogP of 3.44, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(Z)-2-hydroxy-3,3-dimethylbut-1-enyl]-6-methyl-1,4-benzoxazin-2-one is sourced from PubChem (CID 135469893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).