About 5-azido-3-methyl-1H-1,2,4-triazole
5-azido-3-methyl-1H-1,2,4-triazole (PubChem CID 135470574) has the molecular formula C3H4N6
and a molecular weight of 124.11 g/mol. Its IUPAC name is 5-azido-3-methyl-1H-1,2,4-triazole.
Molecular Properties
| Compound Name | 5-azido-3-methyl-1H-1,2,4-triazole |
| PubChem CID | 135470574 |
| Molecular Formula | C3H4N6 |
| Molecular Weight | 124.11 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | 5-azido-3-methyl-1H-1,2,4-triazole |
| SMILES | Cc1n[nH]c(N=[N+]=[N-])n1 |
| InChI | InChI=1S/C3H4N6/c1-2-5-3(7-6-2)8-9-4/h1H3,(H,5,6,7) |
| InChIKey | WGPFYYUKVIIOOX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.11 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 5-azido-3-methyl-1H-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-azido-3-methyl-1H-1,2,4-triazole?
The IUPAC name of 5-azido-3-methyl-1H-1,2,4-triazole (CID 135470574) is 5-azido-3-methyl-1H-1,2,4-triazole.
What is the SMILES notation for 5-azido-3-methyl-1H-1,2,4-triazole?
The canonical SMILES for 5-azido-3-methyl-1H-1,2,4-triazole is Cc1n[nH]c(N=[N+]=[N-])n1.
What is the InChIKey of 5-azido-3-methyl-1H-1,2,4-triazole?
The InChIKey is WGPFYYUKVIIOOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N6/c1-2-5-3(7-6-2)8-9-4/h1H3,(H,5,6,7).
What are the key properties of 5-azido-3-methyl-1H-1,2,4-triazole?
5-azido-3-methyl-1H-1,2,4-triazole has a molecular weight of 124.11 g/mol, XLogP of 1.05, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-azido-3-methyl-1H-1,2,4-triazole is sourced from PubChem (CID 135470574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).