C6H6N8O4 — CID 135470609
5-nitro-3-[2-(5-nitro-1H-1,2,4-triazol-3-yl)ethyl]-1H-1,2,4-triazole (PubChem CID 135470609) has the molecular formula C6H6N8O4 and a molecular weight of 254.17 g/mol. Its IUPAC name is 5-nitro-3-[2-(5-nitro-1H-1,2,4-triazol-3-yl)ethyl]-1H-1,2,4-triazole.
| Compound Name | 5-nitro-3-[2-(5-nitro-1H-1,2,4-triazol-3-yl)ethyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 135470609 |
| Molecular Formula | C6H6N8O4 |
| Molecular Weight | 254.17 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 5-nitro-3-[2-(5-nitro-1H-1,2,4-triazol-3-yl)ethyl]-1H-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1nc(CCc2n[nH]c([N+](=O)[O-])n2)n[nH]1 |
| InChI | InChI=1S/C6H6N8O4/c15-13(16)5-7-3(9-11-5)1-2-4-8-6(12-10-4)14(17)18/h1-2H2,(H,7,9,11)(H,8,10,12) |
| InChIKey | JDMGPQZRRYCYJU-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 169.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.17 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|