C22H23BrClN7O3 — CID 135470933
2-[(E)-[[4-(2-bromo-4-methylanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-chloro-6-methoxyphenol (PubChem CID 135470933) has the molecular formula C22H23BrClN7O3 and a molecular weight of 548.83 g/mol. Its IUPAC name is 2-[(E)-[[4-(2-bromo-4-methylanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-chloro-6-methoxyphenol.
| Compound Name | 2-[(E)-[[4-(2-bromo-4-methylanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-chloro-6-methoxyphenol |
|---|---|
| PubChem CID | 135470933 |
| Molecular Formula | C22H23BrClN7O3 |
| Molecular Weight | 548.83 g/mol |
| Exact Mass | 547.07 |
| IUPAC Name | 2-[(E)-[[4-(2-bromo-4-methylanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-chloro-6-methoxyphenol |
| SMILES | COc1cc(Cl)cc(/C=N/Nc2nc(Nc3ccc(C)cc3Br)nc(N3CCOCC3)n2)c1O |
| InChI | InChI=1S/C22H23BrClN7O3/c1-13-3-4-17(16(23)9-13)26-20-27-21(29-22(28-20)31-5-7-34-8-6-31)30-25-12-14-10-15(24)11-18(33-2)19(14)32/h3-4,9-12,32H,5-8H2,1-2H3,(H2,26,27,28,29,30)/b25-12+ |
| InChIKey | NYAKEMCXLCWXCO-BRJLIKDPSA-N |
| XLogP | 4.34 |
| TPSA | 117.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.83 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|