About 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl benzoate
3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl benzoate (PubChem CID 135470960) has the molecular formula C17H16N2O4S
and a molecular weight of 344.39 g/mol. Its IUPAC name is 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl benzoate.
Molecular Properties
| Compound Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl benzoate |
| PubChem CID | 135470960 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl benzoate |
| SMILES | O=C(OCCC/N=C1\NS(=O)(=O)c2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C17H16N2O4S/c20-17(13-7-2-1-3-8-13)23-12-6-11-18-16-14-9-4-5-10-15(14)24(21,22)19-16/h1-5,7-10H,6,11-12H2,(H,18,19) |
| InChIKey | WRQJHPAROVMZAX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl benzoate?
The IUPAC name of 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl benzoate (CID 135470960) is 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl benzoate.
What is the SMILES notation for 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl benzoate?
The canonical SMILES for 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl benzoate is O=C(OCCC/N=C1\NS(=O)(=O)c2ccccc21)c1ccccc1.
What is the InChIKey of 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl benzoate?
The InChIKey is WRQJHPAROVMZAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O4S/c20-17(13-7-2-1-3-8-13)23-12-6-11-18-16-14-9-4-5-10-15(14)24(21,22)19-16/h1-5,7-10H,6,11-12H2,(H,18,19).
What are the key properties of 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl benzoate?
3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl benzoate has a molecular weight of 344.39 g/mol, XLogP of 1.97, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl benzoate is sourced from PubChem (CID 135470960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).