C23H21N3O — CID 135470974
2-(4-ethylphenyl)-5-(4-methoxyphenyl)-3H-1,3,4-benzotriazepine (PubChem CID 135470974) has the molecular formula C23H21N3O and a molecular weight of 355.44 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-5-(4-methoxyphenyl)-3H-1,3,4-benzotriazepine.
| Compound Name | 2-(4-ethylphenyl)-5-(4-methoxyphenyl)-3H-1,3,4-benzotriazepine |
|---|---|
| PubChem CID | 135470974 |
| Molecular Formula | C23H21N3O |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 2-(4-ethylphenyl)-5-(4-methoxyphenyl)-3H-1,3,4-benzotriazepine |
| SMILES | CCc1ccc(C2=Nc3ccccc3C(c3ccc(OC)cc3)=NN2)cc1 |
| InChI | InChI=1S/C23H21N3O/c1-3-16-8-10-18(11-9-16)23-24-21-7-5-4-6-20(21)22(25-26-23)17-12-14-19(27-2)15-13-17/h4-15H,3H2,1-2H3,(H,24,26) |
| InChIKey | MPGHJKQKQXFSER-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |