About 6-tert-butylimino-5,5-dimethylpiperidin-2-one
6-tert-butylimino-5,5-dimethylpiperidin-2-one (PubChem CID 135471157) has the molecular formula C11H20N2O
and a molecular weight of 196.29 g/mol. Its IUPAC name is 6-tert-butylimino-5,5-dimethylpiperidin-2-one.
Molecular Properties
| Compound Name | 6-tert-butylimino-5,5-dimethylpiperidin-2-one |
| PubChem CID | 135471157 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 6-tert-butylimino-5,5-dimethylpiperidin-2-one |
| SMILES | CC(C)(C)/N=C1\NC(=O)CCC1(C)C |
| InChI | InChI=1S/C11H20N2O/c1-10(2,3)13-9-11(4,5)7-6-8(14)12-9/h6-7H2,1-5H3,(H,12,13,14) |
| InChIKey | HNSPBOLNFTYYCG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-tert-butylimino-5,5-dimethylpiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butylimino-5,5-dimethylpiperidin-2-one?
The IUPAC name of 6-tert-butylimino-5,5-dimethylpiperidin-2-one (CID 135471157) is 6-tert-butylimino-5,5-dimethylpiperidin-2-one.
What is the SMILES notation for 6-tert-butylimino-5,5-dimethylpiperidin-2-one?
The canonical SMILES for 6-tert-butylimino-5,5-dimethylpiperidin-2-one is CC(C)(C)/N=C1\NC(=O)CCC1(C)C.
What is the InChIKey of 6-tert-butylimino-5,5-dimethylpiperidin-2-one?
The InChIKey is HNSPBOLNFTYYCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O/c1-10(2,3)13-9-11(4,5)7-6-8(14)12-9/h6-7H2,1-5H3,(H,12,13,14).
What are the key properties of 6-tert-butylimino-5,5-dimethylpiperidin-2-one?
6-tert-butylimino-5,5-dimethylpiperidin-2-one has a molecular weight of 196.29 g/mol, XLogP of 2.12, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butylimino-5,5-dimethylpiperidin-2-one is sourced from PubChem (CID 135471157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).