About 2-(4-hydroxyphenyl)-1,3-benzoxazol-6-ol
2-(4-hydroxyphenyl)-1,3-benzoxazol-6-ol (PubChem CID 135471161) has the molecular formula C13H9NO3
and a molecular weight of 227.22 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-1,3-benzoxazol-6-ol.
Molecular Properties
| Compound Name | 2-(4-hydroxyphenyl)-1,3-benzoxazol-6-ol |
| PubChem CID | 135471161 |
| Molecular Formula | C13H9NO3 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 2-(4-hydroxyphenyl)-1,3-benzoxazol-6-ol |
| SMILES | Oc1ccc(-c2nc3ccc(O)cc3o2)cc1 |
| InChI | InChI=1S/C13H9NO3/c15-9-3-1-8(2-4-9)13-14-11-6-5-10(16)7-12(11)17-13/h1-7,15-16H |
| InChIKey | PDCFEVXISBNCNF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-hydroxyphenyl)-1,3-benzoxazol-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hydroxyphenyl)-1,3-benzoxazol-6-ol?
The IUPAC name of 2-(4-hydroxyphenyl)-1,3-benzoxazol-6-ol (CID 135471161) is 2-(4-hydroxyphenyl)-1,3-benzoxazol-6-ol.
What is the SMILES notation for 2-(4-hydroxyphenyl)-1,3-benzoxazol-6-ol?
The canonical SMILES for 2-(4-hydroxyphenyl)-1,3-benzoxazol-6-ol is Oc1ccc(-c2nc3ccc(O)cc3o2)cc1.
What is the InChIKey of 2-(4-hydroxyphenyl)-1,3-benzoxazol-6-ol?
The InChIKey is PDCFEVXISBNCNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO3/c15-9-3-1-8(2-4-9)13-14-11-6-5-10(16)7-12(11)17-13/h1-7,15-16H.
What are the key properties of 2-(4-hydroxyphenyl)-1,3-benzoxazol-6-ol?
2-(4-hydroxyphenyl)-1,3-benzoxazol-6-ol has a molecular weight of 227.22 g/mol, XLogP of 2.91, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxyphenyl)-1,3-benzoxazol-6-ol is sourced from PubChem (CID 135471161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).