About (Z)-3-[(3,5-dimethyl-1H-pyrazol-4-yl)diazenyl]-4-hydroxy-6-methylhept-3-en-2-one
(Z)-3-[(3,5-dimethyl-1H-pyrazol-4-yl)diazenyl]-4-hydroxy-6-methylhept-3-en-2-one (PubChem CID 135471762) has the molecular formula C13H20N4O2
and a molecular weight of 264.33 g/mol. Its IUPAC name is (Z)-3-[(3,5-dimethyl-1H-pyrazol-4-yl)diazenyl]-4-hydroxy-6-methylhept-3-en-2-one.
Molecular Properties
| Compound Name | (Z)-3-[(3,5-dimethyl-1H-pyrazol-4-yl)diazenyl]-4-hydroxy-6-methylhept-3-en-2-one |
| PubChem CID | 135471762 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | (Z)-3-[(3,5-dimethyl-1H-pyrazol-4-yl)diazenyl]-4-hydroxy-6-methylhept-3-en-2-one |
| SMILES | CC(=O)C(/N=N/c1c(C)n[nH]c1C)=C(/O)CC(C)C |
| InChI | InChI=1S/C13H20N4O2/c1-7(2)6-11(19)13(10(5)18)17-16-12-8(3)14-15-9(12)4/h7,19H,6H2,1-5H3,(H,14,15)/b13-11-,17-16+ |
| InChIKey | ZIBQKYWJLMDPDS-YHQKBTMFSA-N |
| XLogP | 3.51 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-[(3,5-dimethyl-1H-pyrazol-4-yl)diazenyl]-4-hydroxy-6-methylhept-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-[(3,5-dimethyl-1H-pyrazol-4-yl)diazenyl]-4-hydroxy-6-methylhept-3-en-2-one?
The IUPAC name of (Z)-3-[(3,5-dimethyl-1H-pyrazol-4-yl)diazenyl]-4-hydroxy-6-methylhept-3-en-2-one (CID 135471762) is (Z)-3-[(3,5-dimethyl-1H-pyrazol-4-yl)diazenyl]-4-hydroxy-6-methylhept-3-en-2-one.
What is the SMILES notation for (Z)-3-[(3,5-dimethyl-1H-pyrazol-4-yl)diazenyl]-4-hydroxy-6-methylhept-3-en-2-one?
The canonical SMILES for (Z)-3-[(3,5-dimethyl-1H-pyrazol-4-yl)diazenyl]-4-hydroxy-6-methylhept-3-en-2-one is CC(=O)C(/N=N/c1c(C)n[nH]c1C)=C(/O)CC(C)C.
What is the InChIKey of (Z)-3-[(3,5-dimethyl-1H-pyrazol-4-yl)diazenyl]-4-hydroxy-6-methylhept-3-en-2-one?
The InChIKey is ZIBQKYWJLMDPDS-YHQKBTMFSA-N. The full InChI is InChI=1S/C13H20N4O2/c1-7(2)6-11(19)13(10(5)18)17-16-12-8(3)14-15-9(12)4/h7,19H,6H2,1-5H3,(H,14,15)/b13-11-,17-16+.
What are the key properties of (Z)-3-[(3,5-dimethyl-1H-pyrazol-4-yl)diazenyl]-4-hydroxy-6-methylhept-3-en-2-one?
(Z)-3-[(3,5-dimethyl-1H-pyrazol-4-yl)diazenyl]-4-hydroxy-6-methylhept-3-en-2-one has a molecular weight of 264.33 g/mol, XLogP of 3.51, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-[(3,5-dimethyl-1H-pyrazol-4-yl)diazenyl]-4-hydroxy-6-methylhept-3-en-2-one is sourced from PubChem (CID 135471762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).