C20H12N4O2S — CID 135471911
2-(furan-2-yl)-10-thia-5,6,7,12-tetrazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,12,14,16,18-octaen-8-one (PubChem CID 135471911) has the molecular formula C20H12N4O2S and a molecular weight of 372.41 g/mol. Its IUPAC name is 2-(furan-2-yl)-10-thia-5,6,7,12-tetrazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,12,14,16,18-octaen-8-one.
| Compound Name | 2-(furan-2-yl)-10-thia-5,6,7,12-tetrazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,12,14,16,18-octaen-8-one |
|---|---|
| PubChem CID | 135471911 |
| Molecular Formula | C20H12N4O2S |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 2-(furan-2-yl)-10-thia-5,6,7,12-tetrazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,12,14,16,18-octaen-8-one |
| SMILES | O=c1[nH]nnc2c1sc1nc3c(c(-c4ccco4)c12)CCc1ccccc1-3 |
| InChI | InChI=1S/C20H12N4O2S/c25-19-18-17(22-24-23-19)15-14(13-6-3-9-26-13)12-8-7-10-4-1-2-5-11(10)16(12)21-20(15)27-18/h1-6,9H,7-8H2,(H,22,23,25) |
| InChIKey | TWCUKEKJWLGOFP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |