About 2-[(E)-hydroxyiminomethyl]-5,7-dimethylquinolin-8-ol
2-[(E)-hydroxyiminomethyl]-5,7-dimethylquinolin-8-ol (PubChem CID 135472362) has the molecular formula C12H12N2O2
and a molecular weight of 216.24 g/mol. Its IUPAC name is 2-[(E)-hydroxyiminomethyl]-5,7-dimethylquinolin-8-ol.
Molecular Properties
| Compound Name | 2-[(E)-hydroxyiminomethyl]-5,7-dimethylquinolin-8-ol |
| PubChem CID | 135472362 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 2-[(E)-hydroxyiminomethyl]-5,7-dimethylquinolin-8-ol |
| SMILES | Cc1cc(C)c2ccc(/C=N/O)nc2c1O |
| InChI | InChI=1S/C12H12N2O2/c1-7-5-8(2)12(15)11-10(7)4-3-9(14-11)6-13-16/h3-6,15-16H,1-2H3/b13-6+ |
| InChIKey | AYGNPZLVDLAIJB-AWNIVKPZSA-N |
| XLogP | 2.37 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-hydroxyiminomethyl]-5,7-dimethylquinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-hydroxyiminomethyl]-5,7-dimethylquinolin-8-ol?
The IUPAC name of 2-[(E)-hydroxyiminomethyl]-5,7-dimethylquinolin-8-ol (CID 135472362) is 2-[(E)-hydroxyiminomethyl]-5,7-dimethylquinolin-8-ol.
What is the SMILES notation for 2-[(E)-hydroxyiminomethyl]-5,7-dimethylquinolin-8-ol?
The canonical SMILES for 2-[(E)-hydroxyiminomethyl]-5,7-dimethylquinolin-8-ol is Cc1cc(C)c2ccc(/C=N/O)nc2c1O.
What is the InChIKey of 2-[(E)-hydroxyiminomethyl]-5,7-dimethylquinolin-8-ol?
The InChIKey is AYGNPZLVDLAIJB-AWNIVKPZSA-N. The full InChI is InChI=1S/C12H12N2O2/c1-7-5-8(2)12(15)11-10(7)4-3-9(14-11)6-13-16/h3-6,15-16H,1-2H3/b13-6+.
What are the key properties of 2-[(E)-hydroxyiminomethyl]-5,7-dimethylquinolin-8-ol?
2-[(E)-hydroxyiminomethyl]-5,7-dimethylquinolin-8-ol has a molecular weight of 216.24 g/mol, XLogP of 2.37, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-hydroxyiminomethyl]-5,7-dimethylquinolin-8-ol is sourced from PubChem (CID 135472362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).