C16H18N2 — CID 135472708
6-methyl-N-prop-2-enyl-2,3,4,9-tetrahydrocarbazol-1-imine (PubChem CID 135472708) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 6-methyl-N-prop-2-enyl-2,3,4,9-tetrahydrocarbazol-1-imine.
| Compound Name | 6-methyl-N-prop-2-enyl-2,3,4,9-tetrahydrocarbazol-1-imine |
|---|---|
| PubChem CID | 135472708 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 6-methyl-N-prop-2-enyl-2,3,4,9-tetrahydrocarbazol-1-imine |
| SMILES | C=CC/N=C1\CCCc2c1[nH]c1ccc(C)cc21 |
| InChI | InChI=1S/C16H18N2/c1-3-9-17-15-6-4-5-12-13-10-11(2)7-8-14(13)18-16(12)15/h3,7-8,10,18H,1,4-6,9H2,2H3/b17-15+ |
| InChIKey | IRKTWJWJWCWLAS-BMRADRMJSA-N |
| XLogP | 3.79 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|