C27H31FN4O2S — CID 135472726
N-(4-fluorophenyl)-4-[2-[[2-hydroxy-4-(4-methylphenyl)-6-oxocyclohexen-1-yl]methylideneamino]ethyl]piperazine-1-carbothioamide (PubChem CID 135472726) has the molecular formula C27H31FN4O2S and a molecular weight of 494.64 g/mol. Its IUPAC name is N-(4-fluorophenyl)-4-[2-[[2-hydroxy-4-(4-methylphenyl)-6-oxocyclohexen-1-yl]methylideneamino]ethyl]piperazine-1-carbothioamide.
| Compound Name | N-(4-fluorophenyl)-4-[2-[[2-hydroxy-4-(4-methylphenyl)-6-oxocyclohexen-1-yl]methylideneamino]ethyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 135472726 |
| Molecular Formula | C27H31FN4O2S |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | N-(4-fluorophenyl)-4-[2-[[2-hydroxy-4-(4-methylphenyl)-6-oxocyclohexen-1-yl]methylideneamino]ethyl]piperazine-1-carbothioamide |
| SMILES | Cc1ccc(C2CC(=O)C(/C=N/CCN3CCN(C(=S)Nc4ccc(F)cc4)CC3)=C(O)C2)cc1 |
| InChI | InChI=1S/C27H31FN4O2S/c1-19-2-4-20(5-3-19)21-16-25(33)24(26(34)17-21)18-29-10-11-31-12-14-32(15-13-31)27(35)30-23-8-6-22(28)7-9-23/h2-9,18,21,33H,10-17H2,1H3,(H,30,35)/b29-18+ |
| InChIKey | ZXJPQSOHHUVIBR-RDRPBHBLSA-N |
| XLogP | 4.48 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|