About 2-(3,4-dimethylanilino)-4-methylquinolin-7-ol;hydrochloride
2-(3,4-dimethylanilino)-4-methylquinolin-7-ol;hydrochloride (PubChem CID 135472789) has the molecular formula C18H19ClN2O
and a molecular weight of 314.82 g/mol. Its IUPAC name is 2-(3,4-dimethylanilino)-4-methylquinolin-7-ol;hydrochloride.
Molecular Properties
| Compound Name | 2-(3,4-dimethylanilino)-4-methylquinolin-7-ol;hydrochloride |
| PubChem CID | 135472789 |
| Molecular Formula | C18H19ClN2O |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-(3,4-dimethylanilino)-4-methylquinolin-7-ol;hydrochloride |
| SMILES | Cc1ccc(Nc2cc(C)c3ccc(O)cc3n2)cc1C.Cl |
| InChI | InChI=1S/C18H18N2O.ClH/c1-11-4-5-14(8-12(11)2)19-18-9-13(3)16-7-6-15(21)10-17(16)20-18;/h4-10,21H,1-3H3,(H,19,20);1H |
| InChIKey | DIRZUVDMGFYHGA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,4-dimethylanilino)-4-methylquinolin-7-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethylanilino)-4-methylquinolin-7-ol;hydrochloride?
The IUPAC name of 2-(3,4-dimethylanilino)-4-methylquinolin-7-ol;hydrochloride (CID 135472789) is 2-(3,4-dimethylanilino)-4-methylquinolin-7-ol;hydrochloride.
What is the SMILES notation for 2-(3,4-dimethylanilino)-4-methylquinolin-7-ol;hydrochloride?
The canonical SMILES for 2-(3,4-dimethylanilino)-4-methylquinolin-7-ol;hydrochloride is Cc1ccc(Nc2cc(C)c3ccc(O)cc3n2)cc1C.Cl.
What is the InChIKey of 2-(3,4-dimethylanilino)-4-methylquinolin-7-ol;hydrochloride?
The InChIKey is DIRZUVDMGFYHGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O.ClH/c1-11-4-5-14(8-12(11)2)19-18-9-13(3)16-7-6-15(21)10-17(16)20-18;/h4-10,21H,1-3H3,(H,19,20);1H.
What are the key properties of 2-(3,4-dimethylanilino)-4-methylquinolin-7-ol;hydrochloride?
2-(3,4-dimethylanilino)-4-methylquinolin-7-ol;hydrochloride has a molecular weight of 314.82 g/mol, XLogP of 5.03, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethylanilino)-4-methylquinolin-7-ol;hydrochloride is sourced from PubChem (CID 135472789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).