About 1-(3,4-dichlorophenyl)-2-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]guanidine
1-(3,4-dichlorophenyl)-2-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]guanidine (PubChem CID 135473117) has the molecular formula C13H13Cl2N5O2
and a molecular weight of 342.19 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]guanidine.
Molecular Properties
| Compound Name | 1-(3,4-dichlorophenyl)-2-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]guanidine |
| PubChem CID | 135473117 |
| Molecular Formula | C13H13Cl2N5O2 |
| Molecular Weight | 342.19 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]guanidine |
| SMILES | COCc1cc(=O)[nH]c(/N=C(\N)Nc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C13H13Cl2N5O2/c1-22-6-8-5-11(21)19-13(18-8)20-12(16)17-7-2-3-9(14)10(15)4-7/h2-5H,6H2,1H3,(H4,16,17,18,19,20,21) |
| InChIKey | MLUJQMFLXKJTOJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.19 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,4-dichlorophenyl)-2-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dichlorophenyl)-2-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]guanidine?
The IUPAC name of 1-(3,4-dichlorophenyl)-2-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]guanidine (CID 135473117) is 1-(3,4-dichlorophenyl)-2-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]guanidine.
What is the SMILES notation for 1-(3,4-dichlorophenyl)-2-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]guanidine?
The canonical SMILES for 1-(3,4-dichlorophenyl)-2-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]guanidine is COCc1cc(=O)[nH]c(/N=C(\N)Nc2ccc(Cl)c(Cl)c2)n1.
What is the InChIKey of 1-(3,4-dichlorophenyl)-2-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]guanidine?
The InChIKey is MLUJQMFLXKJTOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13Cl2N5O2/c1-22-6-8-5-11(21)19-13(18-8)20-12(16)17-7-2-3-9(14)10(15)4-7/h2-5H,6H2,1H3,(H4,16,17,18,19,20,21).
What are the key properties of 1-(3,4-dichlorophenyl)-2-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]guanidine?
1-(3,4-dichlorophenyl)-2-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]guanidine has a molecular weight of 342.19 g/mol, XLogP of 2.28, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dichlorophenyl)-2-[4-(methoxymethyl)-6-oxo-1H-pyrimidin-2-yl]guanidine is sourced from PubChem (CID 135473117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).