C19H18Cl2N4OS — CID 135473258
(2Z)-5-[(2,5-dichlorophenyl)methyl]-2-[(Z)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135473258) has the molecular formula C19H18Cl2N4OS and a molecular weight of 421.35 g/mol. Its IUPAC name is (2Z)-5-[(2,5-dichlorophenyl)methyl]-2-[(Z)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-5-[(2,5-dichlorophenyl)methyl]-2-[(Z)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135473258 |
| Molecular Formula | C19H18Cl2N4OS |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | (2Z)-5-[(2,5-dichlorophenyl)methyl]-2-[(Z)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | CN(C)c1ccc(/C=N\N=C2\NC(=O)C(Cc3cc(Cl)ccc3Cl)S2)cc1 |
| InChI | InChI=1S/C19H18Cl2N4OS/c1-25(2)15-6-3-12(4-7-15)11-22-24-19-23-18(26)17(27-19)10-13-9-14(20)5-8-16(13)21/h3-9,11,17H,10H2,1-2H3,(H,23,24,26)/b22-11- |
| InChIKey | VZXDTSOMVXRVOU-JJFYIABZSA-N |
| XLogP | 4.22 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|