C15H17N5O3 — CID 135473416
methyl 2-[2-[(E)-[amino-(4-methylanilino)methylidene]amino]-6-oxo-1H-pyrimidin-4-yl]acetate (PubChem CID 135473416) has the molecular formula C15H17N5O3 and a molecular weight of 315.33 g/mol. Its IUPAC name is methyl 2-[2-[(E)-[amino-(4-methylanilino)methylidene]amino]-6-oxo-1H-pyrimidin-4-yl]acetate.
| Compound Name | methyl 2-[2-[(E)-[amino-(4-methylanilino)methylidene]amino]-6-oxo-1H-pyrimidin-4-yl]acetate |
|---|---|
| PubChem CID | 135473416 |
| Molecular Formula | C15H17N5O3 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | methyl 2-[2-[(E)-[amino-(4-methylanilino)methylidene]amino]-6-oxo-1H-pyrimidin-4-yl]acetate |
| SMILES | COC(=O)Cc1cc(=O)[nH]c(/N=C(\N)Nc2ccc(C)cc2)n1 |
| InChI | InChI=1S/C15H17N5O3/c1-9-3-5-10(6-4-9)17-14(16)20-15-18-11(7-12(21)19-15)8-13(22)23-2/h3-7H,8H2,1-2H3,(H4,16,17,18,19,20,21) |
| InChIKey | MMRWPONEXHGXHR-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 122.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|