About 1-cyclohexyl-3,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one
1-cyclohexyl-3,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one (PubChem CID 135473418) has the molecular formula C14H19N3O
and a molecular weight of 245.33 g/mol. Its IUPAC name is 1-cyclohexyl-3,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one.
Molecular Properties
| Compound Name | 1-cyclohexyl-3,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one |
| PubChem CID | 135473418 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 1-cyclohexyl-3,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one |
| SMILES | Cc1cc(=O)[nH]c2c1c(C)nn2C1CCCCC1 |
| InChI | InChI=1S/C14H19N3O/c1-9-8-12(18)15-14-13(9)10(2)16-17(14)11-6-4-3-5-7-11/h8,11H,3-7H2,1-2H3,(H,15,18) |
| InChIKey | OFKWMESPTPUKLE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclohexyl-3,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-3,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one?
The IUPAC name of 1-cyclohexyl-3,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one (CID 135473418) is 1-cyclohexyl-3,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one.
What is the SMILES notation for 1-cyclohexyl-3,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one?
The canonical SMILES for 1-cyclohexyl-3,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one is Cc1cc(=O)[nH]c2c1c(C)nn2C1CCCCC1.
What is the InChIKey of 1-cyclohexyl-3,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one?
The InChIKey is OFKWMESPTPUKLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O/c1-9-8-12(18)15-14-13(9)10(2)16-17(14)11-6-4-3-5-7-11/h8,11H,3-7H2,1-2H3,(H,15,18).
What are the key properties of 1-cyclohexyl-3,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one?
1-cyclohexyl-3,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one has a molecular weight of 245.33 g/mol, XLogP of 2.85, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-3,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one is sourced from PubChem (CID 135473418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).