About 4-[(E,3Z)-3-hydroxyiminobut-1-enyl]phenol
4-[(E,3Z)-3-hydroxyiminobut-1-enyl]phenol (PubChem CID 135473437) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is 4-[(E,3Z)-3-hydroxyiminobut-1-enyl]phenol.
Molecular Properties
| Compound Name | 4-[(E,3Z)-3-hydroxyiminobut-1-enyl]phenol |
| PubChem CID | 135473437 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 4-[(E,3Z)-3-hydroxyiminobut-1-enyl]phenol |
| SMILES | CC(/C=C/c1ccc(O)cc1)=N/O |
| InChI | InChI=1S/C10H11NO2/c1-8(11-13)2-3-9-4-6-10(12)7-5-9/h2-7,12-13H,1H3/b3-2+,11-8- |
| InChIKey | AOIRAUWUJSIHDZ-HKBOBWAKSA-N |
| XLogP | 2.26 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E,3Z)-3-hydroxyiminobut-1-enyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E,3Z)-3-hydroxyiminobut-1-enyl]phenol?
The IUPAC name of 4-[(E,3Z)-3-hydroxyiminobut-1-enyl]phenol (CID 135473437) is 4-[(E,3Z)-3-hydroxyiminobut-1-enyl]phenol.
What is the SMILES notation for 4-[(E,3Z)-3-hydroxyiminobut-1-enyl]phenol?
The canonical SMILES for 4-[(E,3Z)-3-hydroxyiminobut-1-enyl]phenol is CC(/C=C/c1ccc(O)cc1)=N/O.
What is the InChIKey of 4-[(E,3Z)-3-hydroxyiminobut-1-enyl]phenol?
The InChIKey is AOIRAUWUJSIHDZ-HKBOBWAKSA-N. The full InChI is InChI=1S/C10H11NO2/c1-8(11-13)2-3-9-4-6-10(12)7-5-9/h2-7,12-13H,1H3/b3-2+,11-8-.
What are the key properties of 4-[(E,3Z)-3-hydroxyiminobut-1-enyl]phenol?
4-[(E,3Z)-3-hydroxyiminobut-1-enyl]phenol has a molecular weight of 177.20 g/mol, XLogP of 2.26, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E,3Z)-3-hydroxyiminobut-1-enyl]phenol is sourced from PubChem (CID 135473437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).