About 3-pyridin-4-ylquinoline-5,7-diol
3-pyridin-4-ylquinoline-5,7-diol (PubChem CID 135474209) has the molecular formula C14H10N2O2
and a molecular weight of 238.25 g/mol. Its IUPAC name is 3-pyridin-4-ylquinoline-5,7-diol.
Molecular Properties
| Compound Name | 3-pyridin-4-ylquinoline-5,7-diol |
| PubChem CID | 135474209 |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 3-pyridin-4-ylquinoline-5,7-diol |
| SMILES | Oc1cc(O)c2cc(-c3ccncc3)cnc2c1 |
| InChI | InChI=1S/C14H10N2O2/c17-11-6-13-12(14(18)7-11)5-10(8-16-13)9-1-3-15-4-2-9/h1-8,17-18H |
| InChIKey | QYWQBBCHWNMFSG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-pyridin-4-ylquinoline-5,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridin-4-ylquinoline-5,7-diol?
The IUPAC name of 3-pyridin-4-ylquinoline-5,7-diol (CID 135474209) is 3-pyridin-4-ylquinoline-5,7-diol.
What is the SMILES notation for 3-pyridin-4-ylquinoline-5,7-diol?
The canonical SMILES for 3-pyridin-4-ylquinoline-5,7-diol is Oc1cc(O)c2cc(-c3ccncc3)cnc2c1.
What is the InChIKey of 3-pyridin-4-ylquinoline-5,7-diol?
The InChIKey is QYWQBBCHWNMFSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O2/c17-11-6-13-12(14(18)7-11)5-10(8-16-13)9-1-3-15-4-2-9/h1-8,17-18H.
What are the key properties of 3-pyridin-4-ylquinoline-5,7-diol?
3-pyridin-4-ylquinoline-5,7-diol has a molecular weight of 238.25 g/mol, XLogP of 2.71, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-4-ylquinoline-5,7-diol is sourced from PubChem (CID 135474209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).