C20H25N8O18P3 — CID 135474546
bis[[(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] hydrogen phosphate (PubChem CID 135474546) has the molecular formula C20H25N8O18P3 and a molecular weight of 758.38 g/mol. Its IUPAC name is bis[[(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] hydrogen phosphate.
| Compound Name | bis[[(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 135474546 |
| Molecular Formula | C20H25N8O18P3 |
| Molecular Weight | 758.38 g/mol |
| Exact Mass | 758.05 |
| IUPAC Name | bis[[(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] hydrogen phosphate |
| SMILES | O=c1[nH]cnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](n3cnc4c(=O)[nH]cnc43)[C@H](O)[C@@H]2O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H25N8O18P3/c29-11-7(43-19(13(11)31)27-5-25-9-15(27)21-3-23-17(9)33)1-41-47(35,36)45-49(39,40)46-48(37,38)42-2-8-12(30)14(32)20(44-8)28-6-26-10-16(28)22-4-24-18(10)34/h3-8,11-14,19-20,29-32H,1-2H2,(H,35,36)(H,37,38)(H,39,40)(H,21,23,33)(H,22,24,34)/t7-,8-,11-,12-,13-,14-,19-,20-/m1/s1 |
| InChIKey | CVHNSHAXDYTPBC-XPWFQUROSA-N |
| XLogP | -3.14 |
| TPSA | 375.34 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.38 |
| LogP ≤ 5 | -3.14 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|