C19H12IN6O4S2+ — CID 135474820
4-[2-(2,4-dinitrophenyl)-3-(4-iodophenyl)tetrazol-2-ium-5-yl]benzene-1,3-dithiol (PubChem CID 135474820) has the molecular formula C19H12IN6O4S2+ and a molecular weight of 579.38 g/mol. Its IUPAC name is 4-[2-(2,4-dinitrophenyl)-3-(4-iodophenyl)tetrazol-2-ium-5-yl]benzene-1,3-dithiol.
| Compound Name | 4-[2-(2,4-dinitrophenyl)-3-(4-iodophenyl)tetrazol-2-ium-5-yl]benzene-1,3-dithiol |
|---|---|
| PubChem CID | 135474820 |
| Molecular Formula | C19H12IN6O4S2+ |
| Molecular Weight | 579.38 g/mol |
| Exact Mass | 578.94 |
| IUPAC Name | 4-[2-(2,4-dinitrophenyl)-3-(4-iodophenyl)tetrazol-2-ium-5-yl]benzene-1,3-dithiol |
| SMILES | O=[N+]([O-])c1ccc(-[n+]2nc(-c3ccc(S)cc3S)nn2-c2ccc(I)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H11IN6O4S2/c20-11-1-3-12(4-2-11)23-21-19(15-7-6-14(31)10-18(15)32)22-24(23)16-8-5-13(25(27)28)9-17(16)26(29)30/h1-10H,(H-,21,22,31,32)/p+1 |
| InChIKey | HMHAZFHSQWTIQK-UHFFFAOYSA-O |
| XLogP | 4.21 |
| TPSA | 120.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|