C15H25N2O2+ — CID 135475030
3-hydroxy-5,5-dimethyl-2-(piperidin-1-ium-4-ylmethyliminomethyl)cyclohex-2-en-1-one (PubChem CID 135475030) has the molecular formula C15H25N2O2+ and a molecular weight of 265.38 g/mol. Its IUPAC name is 3-hydroxy-5,5-dimethyl-2-(piperidin-1-ium-4-ylmethyliminomethyl)cyclohex-2-en-1-one.
| Compound Name | 3-hydroxy-5,5-dimethyl-2-(piperidin-1-ium-4-ylmethyliminomethyl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135475030 |
| Molecular Formula | C15H25N2O2+ |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | 3-hydroxy-5,5-dimethyl-2-(piperidin-1-ium-4-ylmethyliminomethyl)cyclohex-2-en-1-one |
| SMILES | CC1(C)CC(=O)C(/C=N/CC2CC[NH2+]CC2)=C(O)C1 |
| InChI | InChI=1S/C15H24N2O2/c1-15(2)7-13(18)12(14(19)8-15)10-17-9-11-3-5-16-6-4-11/h10-11,16,18H,3-9H2,1-2H3/p+1/b17-10+ |
| InChIKey | HEHMEOGDKHIDON-LICLKQGHSA-O |
| XLogP | 1.23 |
| TPSA | 66.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|